MQAE
Catalog No: FT-0629283
CAS No: 162558-52-3
- Chemical Name: MQAE
- Molecular Formula: C14H16BrNO3
- Molecular Weight: 326.19
- InChI Key: DSLLHVISNOIYHR-UHFFFAOYSA-M
- InChI: InChI=1S/C14H16NO3.BrH/c1-3-18-14(16)10-15-8-4-5-11-9-12(17-2)6-7-13(11)15;/h4-9H,3,10H2,1-2H3;1H/q+1;/p-1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 326.18600 |
| Density: | N/A |
| CAS: | 162558-52-3 |
| Bolling_Point: | N/A |
| Product_Name: | MQAE |
| Melting_Point: | 177-179ºC(lit.) |
| Flash_Point: | N/A |
| MF: | C14H16BrNO3 |
| Exact_Mass: | 325.03100 |
|---|---|
| MF: | C14H16BrNO3 |
| FW: | 326.18600 |
| Melting_Point: | 177-179ºC(lit.) |
| PSA: | 39.41000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933499090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)